About N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride
N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride (PubChem CID 139481028) has the molecular formula C5H9FN2
and a molecular weight of 116.14 g/mol. Its IUPAC name is N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride.
Molecular Properties
| Compound Name | N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride |
| PubChem CID | 139481028 |
| Molecular Formula | C5H9FN2 |
| Molecular Weight | 116.14 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride |
| SMILES | C=C/N=C(\F)N(C)C |
| InChI | InChI=1S/C5H9FN2/c1-4-7-5(6)8(2)3/h4H,1H2,2-3H3/b7-5+ |
| InChIKey | GQBDLVMKTIIEIS-FNORWQNLSA-N |
| XLogP | 1.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride?
The IUPAC name of N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride (CID 139481028) is N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride.
What is the SMILES notation for N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride?
The canonical SMILES for N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride is C=C/N=C(\F)N(C)C.
What is the InChIKey of N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride?
The InChIKey is GQBDLVMKTIIEIS-FNORWQNLSA-N. The full InChI is InChI=1S/C5H9FN2/c1-4-7-5(6)8(2)3/h4H,1H2,2-3H3/b7-5+.
What are the key properties of N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride?
N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride has a molecular weight of 116.14 g/mol, XLogP of 1.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyl-N,N-dimethylcarbamimidoyl fluoride is sourced from PubChem (CID 139481028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).