C32H39N7O3 — CID 139481361
(2S)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid (PubChem CID 139481361) has the molecular formula C32H39N7O3 and a molecular weight of 569.71 g/mol. Its IUPAC name is (2S)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139481361 |
| Molecular Formula | C32H39N7O3 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | (2S)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
| SMILES | Cc1ncccc1OCCN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ncnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C32H39N7O3/c1-23-29(12-7-16-33-23)42-21-20-39(18-5-4-9-25-14-13-24-8-6-17-34-30(24)37-25)19-15-28(32(40)41)38-31-26-10-2-3-11-27(26)35-22-36-31/h2-3,7,10-14,16,22,28H,4-6,8-9,15,17-21H2,1H3,(H,34,37)(H,40,41)(H,35,36,38)/t28-/m0/s1 |
| InChIKey | KCTCSJRKZCYUPW-NDEPHWFRSA-N |
| XLogP | 4.75 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|