About 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione
4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione (PubChem CID 139481854) has the molecular formula C23H14N2O5
and a molecular weight of 398.37 g/mol. Its IUPAC name is 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione |
| PubChem CID | 139481854 |
| Molecular Formula | C23H14N2O5 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(Oc3cccc4c3C(=O)N(c3ccccc3)C4=O)cc2C1=O |
| InChI | InChI=1S/C23H14N2O5/c1-24-20(26)15-11-10-14(12-17(15)21(24)27)30-18-9-5-8-16-19(18)23(29)25(22(16)28)13-6-3-2-4-7-13/h2-12H,1H3 |
| InChIKey | DIOXDKBGAKKOIP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione?
The IUPAC name of 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione (CID 139481854) is 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione.
What is the SMILES notation for 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione?
The canonical SMILES for 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione is CN1C(=O)c2ccc(Oc3cccc4c3C(=O)N(c3ccccc3)C4=O)cc2C1=O.
What is the InChIKey of 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione?
The InChIKey is DIOXDKBGAKKOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14N2O5/c1-24-20(26)15-11-10-14(12-17(15)21(24)27)30-18-9-5-8-16-19(18)23(29)25(22(16)28)13-6-3-2-4-7-13/h2-12H,1H3.
What are the key properties of 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione?
4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione has a molecular weight of 398.37 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-2-phenylisoindole-1,3-dione is sourced from PubChem (CID 139481854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).