C10H16N2 — CID 139482113
N-[(E)-2-(2,3,4,5-tetrahydropyridin-6-yl)prop-1-enyl]ethanimine (PubChem CID 139482113) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-[(E)-2-(2,3,4,5-tetrahydropyridin-6-yl)prop-1-enyl]ethanimine.
| Compound Name | N-[(E)-2-(2,3,4,5-tetrahydropyridin-6-yl)prop-1-enyl]ethanimine |
|---|---|
| PubChem CID | 139482113 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-[(E)-2-(2,3,4,5-tetrahydropyridin-6-yl)prop-1-enyl]ethanimine |
| SMILES | C/C=N/C=C(\C)C1=NCCCC1 |
| InChI | InChI=1S/C10H16N2/c1-3-11-8-9(2)10-6-4-5-7-12-10/h3,8H,4-7H2,1-2H3/b9-8+,11-3+ |
| InChIKey | BBYRUYUQEXGWJC-NGOBVPNHSA-N |
| XLogP | 2.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|