About 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal
2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal (PubChem CID 139482128) has the molecular formula C14H20FNO2
and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal.
Molecular Properties
| Compound Name | 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal |
| PubChem CID | 139482128 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal |
| SMILES | Cc1cc(F)ccc1[C@@H](C)[C@@H](C)OCC(N)C=O |
| InChI | InChI=1S/C14H20FNO2/c1-9-6-12(15)4-5-14(9)10(2)11(3)18-8-13(16)7-17/h4-7,10-11,13H,8,16H2,1-3H3/t10-,11+,13?/m0/s1 |
| InChIKey | IELFMORWEVKJDS-VUDPYIQVSA-N |
| XLogP | 2.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal?
The IUPAC name of 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal (CID 139482128) is 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal.
What is the SMILES notation for 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal?
The canonical SMILES for 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal is Cc1cc(F)ccc1[C@@H](C)[C@@H](C)OCC(N)C=O.
What is the InChIKey of 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal?
The InChIKey is IELFMORWEVKJDS-VUDPYIQVSA-N. The full InChI is InChI=1S/C14H20FNO2/c1-9-6-12(15)4-5-14(9)10(2)11(3)18-8-13(16)7-17/h4-7,10-11,13H,8,16H2,1-3H3/t10-,11+,13?/m0/s1.
What are the key properties of 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal?
2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal has a molecular weight of 253.32 g/mol, XLogP of 2.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(2R,3R)-3-(4-fluoro-2-methylphenyl)butan-2-yl]oxypropanal is sourced from PubChem (CID 139482128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).