C20H18F2N6O2 — CID 139482352
1,3-benzoxazol-6-yl-[(3S,4R)-3-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-4-methylpiperidin-1-yl]methanone (PubChem CID 139482352) has the molecular formula C20H18F2N6O2 and a molecular weight of 412.40 g/mol. Its IUPAC name is 1,3-benzoxazol-6-yl-[(3S,4R)-3-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-4-methylpiperidin-1-yl]methanone.
| Compound Name | 1,3-benzoxazol-6-yl-[(3S,4R)-3-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-4-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 139482352 |
| Molecular Formula | C20H18F2N6O2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1,3-benzoxazol-6-yl-[(3S,4R)-3-[5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-4-methylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CCN(C(=O)c2ccc3ncoc3c2)C[C@H]1c1cc(C(F)F)nc2ncnn12 |
| InChI | InChI=1S/C20H18F2N6O2/c1-11-4-5-27(19(29)12-2-3-14-17(6-12)30-10-24-14)8-13(11)16-7-15(18(21)22)26-20-23-9-25-28(16)20/h2-3,6-7,9-11,13,18H,4-5,8H2,1H3/t11-,13-/m1/s1 |
| InChIKey | DOLGRTQBVJTCIJ-DGCLKSJQSA-N |
| XLogP | 3.47 |
| TPSA | 89.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |