C11H10N2 — CID 139482581
(4aZ,6Z,8Z,10E)-cycloocta[c]pyridin-3-amine (PubChem CID 139482581) has the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (4aZ,6Z,8Z,10E)-cycloocta[c]pyridin-3-amine.
| Compound Name | (4aZ,6Z,8Z,10E)-cycloocta[c]pyridin-3-amine |
|---|---|
| PubChem CID | 139482581 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | (4aZ,6Z,8Z,10E)-cycloocta[c]pyridin-3-amine |
| SMILES | Nc1cc2/c(cn1)=C\C=C/C=C\C=2 |
| InChI | InChI=1S/C11H10N2/c12-11-7-9-5-3-1-2-4-6-10(9)8-13-11/h1-8H,(H2,12,13)/b2-1-,3-1-,4-2-,5-3-,6-4-,9-5-,10-6- |
| InChIKey | MNEUAXKFQRURHZ-CKSLBRPTSA-N |
| XLogP | 0.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |