C29H35N7O2 — CID 139482658
1-(3-hydroxy-3-methyl-1,2,5,6-tetrahydroinden-5-yl)-6-[4-(4-methylpiperazin-1-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 139482658) has the molecular formula C29H35N7O2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 1-(3-hydroxy-3-methyl-1,2,5,6-tetrahydroinden-5-yl)-6-[4-(4-methylpiperazin-1-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(3-hydroxy-3-methyl-1,2,5,6-tetrahydroinden-5-yl)-6-[4-(4-methylpiperazin-1-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 139482658 |
| Molecular Formula | C29H35N7O2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 1-(3-hydroxy-3-methyl-1,2,5,6-tetrahydroinden-5-yl)-6-[4-(4-methylpiperazin-1-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2n1C1C=C2C(=CC1)CCC2(C)O |
| InChI | InChI=1S/C29H35N7O2/c1-4-13-35-27(37)24-19-30-28(31-21-6-9-22(10-7-21)34-16-14-33(3)15-17-34)32-26(24)36(35)23-8-5-20-11-12-29(2,38)25(20)18-23/h4-7,9-10,18-19,23,38H,1,8,11-17H2,2-3H3,(H,30,31,32) |
| InChIKey | UOFMWHLALCQGSY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|