C15H18F4O — CID 139482953
3-[(4-tert-butyl-2,3,5,6-tetrafluorophenyl)methyl]-3-methyloxetane (PubChem CID 139482953) has the molecular formula C15H18F4O and a molecular weight of 290.30 g/mol. Its IUPAC name is 3-[(4-tert-butyl-2,3,5,6-tetrafluorophenyl)methyl]-3-methyloxetane.
| Compound Name | 3-[(4-tert-butyl-2,3,5,6-tetrafluorophenyl)methyl]-3-methyloxetane |
|---|---|
| PubChem CID | 139482953 |
| Molecular Formula | C15H18F4O |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-[(4-tert-butyl-2,3,5,6-tetrafluorophenyl)methyl]-3-methyloxetane |
| SMILES | CC1(Cc2c(F)c(F)c(C(C)(C)C)c(F)c2F)COC1 |
| InChI | InChI=1S/C15H18F4O/c1-14(2,3)9-12(18)10(16)8(11(17)13(9)19)5-15(4)6-20-7-15/h5-7H2,1-4H3 |
| InChIKey | JUMKEVFHVPHODA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|