C10H15N — CID 139483013
1,2,3,4,5,6-hexahydronaphthalen-1-amine (PubChem CID 139483013) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydronaphthalen-1-amine.
| Compound Name | 1,2,3,4,5,6-hexahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 139483013 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1,2,3,4,5,6-hexahydronaphthalen-1-amine |
| SMILES | NC1CCCC2=C1C=CCC2 |
| InChI | InChI=1S/C10H15N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h2,6,10H,1,3-5,7,11H2 |
| InChIKey | RYHVFHURPJIIKF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |