C15H24N2 — CID 139483250
7-tert-butyl-8-propan-2-yl-5,6,7,8-tetrahydroquinazoline (PubChem CID 139483250) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 7-tert-butyl-8-propan-2-yl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 7-tert-butyl-8-propan-2-yl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 139483250 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 7-tert-butyl-8-propan-2-yl-5,6,7,8-tetrahydroquinazoline |
| SMILES | CC(C)C1c2ncncc2CCC1C(C)(C)C |
| InChI | InChI=1S/C15H24N2/c1-10(2)13-12(15(3,4)5)7-6-11-8-16-9-17-14(11)13/h8-10,12-13H,6-7H2,1-5H3 |
| InChIKey | BYQLUJBCTLSXGX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |