C15H18F6N2O — CID 139483884
(3S,5S,6R)-3-amino-6-methyl-1-(2,2,2-trifluoroethyl)-5-[(3Z,5E)-3,4,6-trifluorohepta-1,3,5-trien-2-yl]piperidin-2-one (PubChem CID 139483884) has the molecular formula C15H18F6N2O and a molecular weight of 356.31 g/mol. Its IUPAC name is (3S,5S,6R)-3-amino-6-methyl-1-(2,2,2-trifluoroethyl)-5-[(3Z,5E)-3,4,6-trifluorohepta-1,3,5-trien-2-yl]piperidin-2-one.
| Compound Name | (3S,5S,6R)-3-amino-6-methyl-1-(2,2,2-trifluoroethyl)-5-[(3Z,5E)-3,4,6-trifluorohepta-1,3,5-trien-2-yl]piperidin-2-one |
|---|---|
| PubChem CID | 139483884 |
| Molecular Formula | C15H18F6N2O |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (3S,5S,6R)-3-amino-6-methyl-1-(2,2,2-trifluoroethyl)-5-[(3Z,5E)-3,4,6-trifluorohepta-1,3,5-trien-2-yl]piperidin-2-one |
| SMILES | C=C(/C(F)=C(F)\C=C(/C)F)[C@@H]1C[C@H](N)C(=O)N(CC(F)(F)F)[C@@H]1C |
| InChI | InChI=1S/C15H18F6N2O/c1-7(16)4-11(17)13(18)8(2)10-5-12(22)14(24)23(9(10)3)6-15(19,20)21/h4,9-10,12H,2,5-6,22H2,1,3H3/b7-4+,13-11-/t9-,10+,12+/m1/s1 |
| InChIKey | DORLFASBUFNQRO-JLCVOJQASA-N |
| XLogP | 3.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|