C16H22F4N2O — CID 139483887
(3S,5S,6R)-3-amino-5-[(3E,5Z)-4-fluoro-3-methylhepta-1,3,5-trien-2-yl]-6-methyl-1-(2,2,2-trifluoroethyl)piperidin-2-one (PubChem CID 139483887) has the molecular formula C16H22F4N2O and a molecular weight of 334.36 g/mol. Its IUPAC name is (3S,5S,6R)-3-amino-5-[(3E,5Z)-4-fluoro-3-methylhepta-1,3,5-trien-2-yl]-6-methyl-1-(2,2,2-trifluoroethyl)piperidin-2-one.
| Compound Name | (3S,5S,6R)-3-amino-5-[(3E,5Z)-4-fluoro-3-methylhepta-1,3,5-trien-2-yl]-6-methyl-1-(2,2,2-trifluoroethyl)piperidin-2-one |
|---|---|
| PubChem CID | 139483887 |
| Molecular Formula | C16H22F4N2O |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (3S,5S,6R)-3-amino-5-[(3E,5Z)-4-fluoro-3-methylhepta-1,3,5-trien-2-yl]-6-methyl-1-(2,2,2-trifluoroethyl)piperidin-2-one |
| SMILES | C=C(/C(C)=C(F)\C=C/C)[C@@H]1C[C@H](N)C(=O)N(CC(F)(F)F)[C@@H]1C |
| InChI | InChI=1S/C16H22F4N2O/c1-5-6-13(17)10(3)9(2)12-7-14(21)15(23)22(11(12)4)8-16(18,19)20/h5-6,11-12,14H,2,7-8,21H2,1,3-4H3/b6-5-,13-10+/t11-,12+,14+/m1/s1 |
| InChIKey | QDJLOADLQGGFBC-RVYLVRAUSA-N |
| XLogP | 3.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|