C16H23F3N2O — CID 139483890
(3S,5S,6R)-3-amino-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-1-(3,3,3-trifluoropropyl)piperidin-2-one (PubChem CID 139483890) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is (3S,5S,6R)-3-amino-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-1-(3,3,3-trifluoropropyl)piperidin-2-one.
| Compound Name | (3S,5S,6R)-3-amino-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-1-(3,3,3-trifluoropropyl)piperidin-2-one |
|---|---|
| PubChem CID | 139483890 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (3S,5S,6R)-3-amino-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methyl-1-(3,3,3-trifluoropropyl)piperidin-2-one |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1C[C@H](N)C(=O)N(CCC(F)(F)F)[C@@H]1C |
| InChI | InChI=1S/C16H23F3N2O/c1-4-5-6-7-11(2)13-10-14(20)15(22)21(12(13)3)9-8-16(17,18)19/h4-7,12-14H,2,8-10,20H2,1,3H3/b5-4-,7-6-/t12-,13+,14+/m1/s1 |
| InChIKey | FZHAOIOBFOWUNK-LNHPMVRKSA-N |
| XLogP | 3.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|