C7H6F10O4S — CID 139483924
2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfonylethanol (PubChem CID 139483924) has the molecular formula C7H6F10O4S and a molecular weight of 376.17 g/mol. Its IUPAC name is 2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfonylethanol.
| Compound Name | 2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfonylethanol |
|---|---|
| PubChem CID | 139483924 |
| Molecular Formula | C7H6F10O4S |
| Molecular Weight | 376.17 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfonylethanol |
| SMILES | O=S(=O)(CCO)C(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F10O4S/c8-3(4(9,10)22(19,20)2-1-18)21-7(16,17)5(11,12)6(13,14)15/h3,18H,1-2H2 |
| InChIKey | PHXJMHKDFSETKD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|