C14H17F5N2O — CID 139483931
(3S,5S)-3-amino-5-[(3Z,5Z)-3,4-difluorohepta-1,3,5-trien-2-yl]-1-(2,2,2-trifluoroethyl)piperidin-2-one (PubChem CID 139483931) has the molecular formula C14H17F5N2O and a molecular weight of 324.29 g/mol. Its IUPAC name is (3S,5S)-3-amino-5-[(3Z,5Z)-3,4-difluorohepta-1,3,5-trien-2-yl]-1-(2,2,2-trifluoroethyl)piperidin-2-one.
| Compound Name | (3S,5S)-3-amino-5-[(3Z,5Z)-3,4-difluorohepta-1,3,5-trien-2-yl]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
|---|---|
| PubChem CID | 139483931 |
| Molecular Formula | C14H17F5N2O |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (3S,5S)-3-amino-5-[(3Z,5Z)-3,4-difluorohepta-1,3,5-trien-2-yl]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
| SMILES | C=C(/C(F)=C(F)\C=C/C)[C@@H]1C[C@H](N)C(=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H17F5N2O/c1-3-4-10(15)12(16)8(2)9-5-11(20)13(22)21(6-9)7-14(17,18)19/h3-4,9,11H,2,5-7,20H2,1H3/b4-3-,12-10-/t9-,11+/m1/s1 |
| InChIKey | IJBAFIRWVLGWKX-UQJDNGSKSA-N |
| XLogP | 3.01 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|