C14H18N+ — CID 139483932
methyl-[(4E,6Z)-3-methylidenenona-1,4,6,8-tetraen-4-yl]-prop-2-enylideneazanium (PubChem CID 139483932) has the molecular formula C14H18N+ and a molecular weight of 200.30 g/mol. Its IUPAC name is methyl-[(4E,6Z)-3-methylidenenona-1,4,6,8-tetraen-4-yl]-prop-2-enylideneazanium.
| Compound Name | methyl-[(4E,6Z)-3-methylidenenona-1,4,6,8-tetraen-4-yl]-prop-2-enylideneazanium |
|---|---|
| PubChem CID | 139483932 |
| Molecular Formula | C14H18N+ |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | methyl-[(4E,6Z)-3-methylidenenona-1,4,6,8-tetraen-4-yl]-prop-2-enylideneazanium |
| SMILES | C=C/C=C\C=C(C(=C)C=C)\[N+](C)=C\C=C |
| InChI | InChI=1S/C14H18N/c1-6-9-10-11-14(13(4)8-3)15(5)12-7-2/h6-12H,1-4H2,5H3/q+1/b10-9-,14-11+,15-12+ |
| InChIKey | MFALHHHVBAENHA-FDHFOKMUSA-N |
| XLogP | 3.25 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|