C13H8F20O3S2 — CID 139484088
2,3-bis[[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanyl]propan-1-ol (PubChem CID 139484088) has the molecular formula C13H8F20O3S2 and a molecular weight of 656.30 g/mol. Its IUPAC name is 2,3-bis[[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanyl]propan-1-ol.
| Compound Name | 2,3-bis[[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 139484088 |
| Molecular Formula | C13H8F20O3S2 |
| Molecular Weight | 656.30 g/mol |
| Exact Mass | 655.96 |
| IUPAC Name | 2,3-bis[[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanyl]propan-1-ol |
| SMILES | OCC(CSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)SC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F20O3S2/c14-4(35-12(30,31)8(20,21)10(24,25)26)6(16,17)37-2-3(1-34)38-7(18,19)5(15)36-13(32,33)9(22,23)11(27,28)29/h3-5,34H,1-2H2 |
| InChIKey | WRUKPJSONRZBAZ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.30 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|