C9H8F10O5S — CID 139484091
2-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]ethaneperoxoic acid (PubChem CID 139484091) has the molecular formula C9H8F10O5S and a molecular weight of 418.21 g/mol. Its IUPAC name is 2-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]ethaneperoxoic acid.
| Compound Name | 2-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]ethaneperoxoic acid |
|---|---|
| PubChem CID | 139484091 |
| Molecular Formula | C9H8F10O5S |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 2-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]sulfanylethoxy]ethaneperoxoic acid |
| SMILES | O=C(COCCSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)OO |
| InChI | InChI=1S/C9H8F10O5S/c10-5(23-9(18,19)7(13,14)8(15,16)17)6(11,12)25-2-1-22-3-4(20)24-21/h5,21H,1-3H2 |
| InChIKey | ZJHFKZJOMKFQDG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|