C20H11F3N4O4 — CID 139485253
[[2-(6-pyridin-3-yl-3-pyridinyl)-1,3-benzoxazole-6-carbonyl]amino] 2,2,2-trifluoroacetate (PubChem CID 139485253) has the molecular formula C20H11F3N4O4 and a molecular weight of 428.33 g/mol. Its IUPAC name is [[2-(6-pyridin-3-yl-3-pyridinyl)-1,3-benzoxazole-6-carbonyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[2-(6-pyridin-3-yl-3-pyridinyl)-1,3-benzoxazole-6-carbonyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139485253 |
| Molecular Formula | C20H11F3N4O4 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | [[2-(6-pyridin-3-yl-3-pyridinyl)-1,3-benzoxazole-6-carbonyl]amino] 2,2,2-trifluoroacetate |
| SMILES | O=C(NOC(=O)C(F)(F)F)c1ccc2nc(-c3ccc(-c4cccnc4)nc3)oc2c1 |
| InChI | InChI=1S/C20H11F3N4O4/c21-20(22,23)19(29)31-27-17(28)11-3-6-15-16(8-11)30-18(26-15)13-4-5-14(25-10-13)12-2-1-7-24-9-12/h1-10H,(H,27,28) |
| InChIKey | TVCXVVZAOJOAAA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|