C19H15F3N6O3 — CID 139486482
7-methyl-1-[[3-[(3R,5R)-5-(3,4,5-trifluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]purin-6-one (PubChem CID 139486482) has the molecular formula C19H15F3N6O3 and a molecular weight of 432.36 g/mol. Its IUPAC name is 7-methyl-1-[[3-[(3R,5R)-5-(3,4,5-trifluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]purin-6-one.
| Compound Name | 7-methyl-1-[[3-[(3R,5R)-5-(3,4,5-trifluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]purin-6-one |
|---|---|
| PubChem CID | 139486482 |
| Molecular Formula | C19H15F3N6O3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 7-methyl-1-[[3-[(3R,5R)-5-(3,4,5-trifluorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]purin-6-one |
| SMILES | Cn1cnc2ncn(Cc3nc([C@@H]4CO[C@@H](c5cc(F)c(F)c(F)c5)C4)no3)c(=O)c21 |
| InChI | InChI=1S/C19H15F3N6O3/c1-27-7-23-18-16(27)19(29)28(8-24-18)5-14-25-17(26-31-14)10-4-13(30-6-10)9-2-11(20)15(22)12(21)3-9/h2-3,7-8,10,13H,4-6H2,1H3/t10-,13+/m0/s1 |
| InChIKey | SSJBHGRPQUDMCG-GXFFZTMASA-N |
| XLogP | 2.22 |
| TPSA | 100.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|