About (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one
(3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one (PubChem CID 139486645) has the molecular formula C27H23Br2NO
and a molecular weight of 537.30 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one.
Molecular Properties
| Compound Name | (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one |
| PubChem CID | 139486645 |
| Molecular Formula | C27H23Br2NO |
| Molecular Weight | 537.30 g/mol |
| Exact Mass | 535.01 |
| IUPAC Name | (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one |
| SMILES | O=C1/C(=C\c2cccc(Br)c2)CN(CCc2ccccc2)C/C1=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C27H23Br2NO/c28-25-10-4-8-21(16-25)14-23-18-30(13-12-20-6-2-1-3-7-20)19-24(27(23)31)15-22-9-5-11-26(29)17-22/h1-11,14-17H,12-13,18-19H2/b23-14-,24-15+ |
| InChIKey | IUYWIBUJNJZTRZ-PMICNGQHSA-N |
| XLogP | 6.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.30 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one?
The IUPAC name of (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one (CID 139486645) is (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one.
What is the SMILES notation for (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one?
The canonical SMILES for (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one is O=C1/C(=C\c2cccc(Br)c2)CN(CCc2ccccc2)C/C1=C\c1cccc(Br)c1.
What is the InChIKey of (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one?
The InChIKey is IUYWIBUJNJZTRZ-PMICNGQHSA-N. The full InChI is InChI=1S/C27H23Br2NO/c28-25-10-4-8-21(16-25)14-23-18-30(13-12-20-6-2-1-3-7-20)19-24(27(23)31)15-22-9-5-11-26(29)17-22/h1-11,14-17H,12-13,18-19H2/b23-14-,24-15+.
What are the key properties of (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one?
(3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one has a molecular weight of 537.30 g/mol, XLogP of 6.81, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-3,5-bis[(3-bromophenyl)methylidene]-1-(2-phenylethyl)piperidin-4-one is sourced from PubChem (CID 139486645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).