About 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one
3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one (PubChem CID 139486699) has the molecular formula C18H17ClN6O3
and a molecular weight of 400.83 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one |
| PubChem CID | 139486699 |
| Molecular Formula | C18H17ClN6O3 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one |
| SMILES | CC(Cn1nc(Cn2cnc3ncn(C)c3c2=O)oc1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN6O3/c1-11(12-3-5-13(19)6-4-12)7-25-18(27)28-14(22-25)8-24-10-21-16-15(17(24)26)23(2)9-20-16/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | KBDWUWKNXJLWES-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 100.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one?
The IUPAC name of 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one (CID 139486699) is 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one?
The canonical SMILES for 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one is CC(Cn1nc(Cn2cnc3ncn(C)c3c2=O)oc1=O)c1ccc(Cl)cc1.
What is the InChIKey of 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one?
The InChIKey is KBDWUWKNXJLWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN6O3/c1-11(12-3-5-13(19)6-4-12)7-25-18(27)28-14(22-25)8-24-10-21-16-15(17(24)26)23(2)9-20-16/h3-6,9-11H,7-8H2,1-2H3.
What are the key properties of 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one?
3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one has a molecular weight of 400.83 g/mol, XLogP of 1.79, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-chlorophenyl)propyl]-5-[(7-methyl-6-oxopurin-1-yl)methyl]-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 139486699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).