C23H20N4O3 — CID 139487293
benzyl 1-[(6-cyclopropyl-8-formylimidazo[1,2-a]pyridin-2-yl)methyl]pyrazole-4-carboxylate (PubChem CID 139487293) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is benzyl 1-[(6-cyclopropyl-8-formylimidazo[1,2-a]pyridin-2-yl)methyl]pyrazole-4-carboxylate.
| Compound Name | benzyl 1-[(6-cyclopropyl-8-formylimidazo[1,2-a]pyridin-2-yl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 139487293 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | benzyl 1-[(6-cyclopropyl-8-formylimidazo[1,2-a]pyridin-2-yl)methyl]pyrazole-4-carboxylate |
| SMILES | O=Cc1cc(C2CC2)cn2cc(Cn3cc(C(=O)OCc4ccccc4)cn3)nc12 |
| InChI | InChI=1S/C23H20N4O3/c28-14-19-8-18(17-6-7-17)10-26-12-21(25-22(19)26)13-27-11-20(9-24-27)23(29)30-15-16-4-2-1-3-5-16/h1-5,8-12,14,17H,6-7,13,15H2 |
| InChIKey | RSPJLUOEYSDDOL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|