About N-[(3,4-dichloro-2-pyridinyl)methyl]formamide
N-[(3,4-dichloro-2-pyridinyl)methyl]formamide (PubChem CID 139487439) has the molecular formula C7H6Cl2N2O
and a molecular weight of 205.04 g/mol. Its IUPAC name is N-[(3,4-dichloro-2-pyridinyl)methyl]formamide.
Molecular Properties
| Compound Name | N-[(3,4-dichloro-2-pyridinyl)methyl]formamide |
| PubChem CID | 139487439 |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | N-[(3,4-dichloro-2-pyridinyl)methyl]formamide |
| SMILES | O=CNCc1nccc(Cl)c1Cl |
| InChI | InChI=1S/C7H6Cl2N2O/c8-5-1-2-11-6(7(5)9)3-10-4-12/h1-2,4H,3H2,(H,10,12) |
| InChIKey | QFXQZLTYVXHOQX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-dichloro-2-pyridinyl)methyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dichloro-2-pyridinyl)methyl]formamide?
The IUPAC name of N-[(3,4-dichloro-2-pyridinyl)methyl]formamide (CID 139487439) is N-[(3,4-dichloro-2-pyridinyl)methyl]formamide.
What is the SMILES notation for N-[(3,4-dichloro-2-pyridinyl)methyl]formamide?
The canonical SMILES for N-[(3,4-dichloro-2-pyridinyl)methyl]formamide is O=CNCc1nccc(Cl)c1Cl.
What is the InChIKey of N-[(3,4-dichloro-2-pyridinyl)methyl]formamide?
The InChIKey is QFXQZLTYVXHOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N2O/c8-5-1-2-11-6(7(5)9)3-10-4-12/h1-2,4H,3H2,(H,10,12).
What are the key properties of N-[(3,4-dichloro-2-pyridinyl)methyl]formamide?
N-[(3,4-dichloro-2-pyridinyl)methyl]formamide has a molecular weight of 205.04 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dichloro-2-pyridinyl)methyl]formamide is sourced from PubChem (CID 139487439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).