C16H16N4O2 — CID 139487885
1-[(5-cyclopropyl-1-methylindol-2-yl)methyl]triazole-4-carboxylic acid (PubChem CID 139487885) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[(5-cyclopropyl-1-methylindol-2-yl)methyl]triazole-4-carboxylic acid.
| Compound Name | 1-[(5-cyclopropyl-1-methylindol-2-yl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 139487885 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-[(5-cyclopropyl-1-methylindol-2-yl)methyl]triazole-4-carboxylic acid |
| SMILES | Cn1c(Cn2cc(C(=O)O)nn2)cc2cc(C3CC3)ccc21 |
| InChI | InChI=1S/C16H16N4O2/c1-19-13(8-20-9-14(16(21)22)17-18-20)7-12-6-11(10-2-3-10)4-5-15(12)19/h4-7,9-10H,2-3,8H2,1H3,(H,21,22) |
| InChIKey | YGFDBGIWEQPEIZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |