C19H19ClN4O5 — CID 139488262
(2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1R)-6-chloro-3-hydroxy-3,4-dihydro-1H-isochromen-1-yl]oxolane-3,4-diol (PubChem CID 139488262) has the molecular formula C19H19ClN4O5 and a molecular weight of 418.84 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1R)-6-chloro-3-hydroxy-3,4-dihydro-1H-isochromen-1-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1R)-6-chloro-3-hydroxy-3,4-dihydro-1H-isochromen-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 139488262 |
| Molecular Formula | C19H19ClN4O5 |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1R)-6-chloro-3-hydroxy-3,4-dihydro-1H-isochromen-1-yl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H]([C@@H]2OC(O)Cc3cc(Cl)ccc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H19ClN4O5/c20-9-1-2-10-8(5-9)6-12(25)28-15(10)16-13(26)14(27)19(29-16)24-4-3-11-17(21)22-7-23-18(11)24/h1-5,7,12-16,19,25-27H,6H2,(H2,21,22,23)/t12?,13-,14+,15+,16-,19+/m0/s1 |
| InChIKey | HQPIJWPBMNFLDK-KUUSOUCTSA-N |
| XLogP | 0.92 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |