C17H16ClN3O4S — CID 139488327
(2S,3S,4R,5R)-2-[(4R)-2-chloro-4,6-dihydrothieno[2,3-c]furan-4-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 139488327) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[(4R)-2-chloro-4,6-dihydrothieno[2,3-c]furan-4-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-[(4R)-2-chloro-4,6-dihydrothieno[2,3-c]furan-4-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 139488327 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (2S,3S,4R,5R)-2-[(4R)-2-chloro-4,6-dihydrothieno[2,3-c]furan-4-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H]([C@@H]2OCc3sc(Cl)cc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H16ClN3O4S/c1-7-8-2-3-21(16(8)20-6-19-7)17-13(23)12(22)15(25-17)14-9-4-11(18)26-10(9)5-24-14/h2-4,6,12-15,17,22-23H,5H2,1H3/t12-,13+,14+,15-,17+/m0/s1 |
| InChIKey | MZVVKJAAWJLSBS-SOXILONMSA-N |
| XLogP | 2.35 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |