C19H17ClN4O4 — CID 139488403
(3R)-3-[(1S,2R,3S,4R)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,3-dihydroxycyclopentyl]-6-chloro-3H-2-benzofuran-1-one (PubChem CID 139488403) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is (3R)-3-[(1S,2R,3S,4R)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,3-dihydroxycyclopentyl]-6-chloro-3H-2-benzofuran-1-one.
| Compound Name | (3R)-3-[(1S,2R,3S,4R)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,3-dihydroxycyclopentyl]-6-chloro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139488403 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (3R)-3-[(1S,2R,3S,4R)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,3-dihydroxycyclopentyl]-6-chloro-3H-2-benzofuran-1-one |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1C[C@H]([C@H]2OC(=O)c3cc(Cl)ccc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H17ClN4O4/c20-8-1-2-9-11(5-8)19(27)28-16(9)12-6-13(15(26)14(12)25)24-4-3-10-17(21)22-7-23-18(10)24/h1-5,7,12-16,25-26H,6H2,(H2,21,22,23)/t12-,13+,14+,15-,16-/m0/s1 |
| InChIKey | AYZHNCVUEKECDO-OTJKEOIZSA-N |
| XLogP | 1.86 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |