C17H17ClN4O4S — CID 139488431
(2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(7S)-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]oxolane-3,4-diol (PubChem CID 139488431) has the molecular formula C17H17ClN4O4S and a molecular weight of 408.87 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(7S)-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(7S)-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 139488431 |
| Molecular Formula | C17H17ClN4O4S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(7S)-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H]([C@@H]2OCCc3cc(Cl)sc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H17ClN4O4S/c18-9-5-7-2-4-25-13(14(7)27-9)12-10(23)11(24)17(26-12)22-3-1-8-15(19)20-6-21-16(8)22/h1,3,5-6,10-13,17,23-24H,2,4H2,(H2,19,20,21)/t10-,11+,12-,13-,17+/m0/s1 |
| InChIKey | OYPQTNGMDHACTQ-NLLNSEBYSA-N |
| XLogP | 1.66 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |