C20H20ClN3O4 — CID 139488492
(2S,3S,4R,5R)-2-[(1R)-5-chloro-3,4-dihydro-1H-isochromen-1-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 139488492) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[(1R)-5-chloro-3,4-dihydro-1H-isochromen-1-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-[(1R)-5-chloro-3,4-dihydro-1H-isochromen-1-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 139488492 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (2S,3S,4R,5R)-2-[(1R)-5-chloro-3,4-dihydro-1H-isochromen-1-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H]([C@@H]2OCCc3c(Cl)cccc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20ClN3O4/c1-10-11-5-7-24(19(11)23-9-22-10)20-16(26)15(25)18(28-20)17-13-3-2-4-14(21)12(13)6-8-27-17/h2-5,7,9,15-18,20,25-26H,6,8H2,1H3/t15-,16+,17+,18-,20+/m0/s1 |
| InChIKey | OKAFTUQEPQNTET-ILRSOXBSSA-N |
| XLogP | 2.33 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |