C20H21ClN4O5 — CID 139488551
(2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1R)-6-chloro-3-methoxy-3,4-dihydro-1H-isochromen-1-yl]oxolane-3,4-diol (PubChem CID 139488551) has the molecular formula C20H21ClN4O5 and a molecular weight of 432.86 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1R)-6-chloro-3-methoxy-3,4-dihydro-1H-isochromen-1-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1R)-6-chloro-3-methoxy-3,4-dihydro-1H-isochromen-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 139488551 |
| Molecular Formula | C20H21ClN4O5 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1R)-6-chloro-3-methoxy-3,4-dihydro-1H-isochromen-1-yl]oxolane-3,4-diol |
| SMILES | COC1Cc2cc(Cl)ccc2[C@H]([C@H]2O[C@@H](n3ccc4c(N)ncnc43)[C@H](O)[C@@H]2O)O1 |
| InChI | InChI=1S/C20H21ClN4O5/c1-28-13-7-9-6-10(21)2-3-11(9)16(29-13)17-14(26)15(27)20(30-17)25-5-4-12-18(22)23-8-24-19(12)25/h2-6,8,13-17,20,26-27H,7H2,1H3,(H2,22,23,24)/t13?,14-,15+,16+,17-,20+/m0/s1 |
| InChIKey | LZOCADXQVPMWPC-CHGXTBDYSA-N |
| XLogP | 1.57 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |