About 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid
4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid (PubChem CID 139489157) has the molecular formula C12H11NO6S
and a molecular weight of 297.29 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid.
Molecular Properties
| Compound Name | 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid |
| PubChem CID | 139489157 |
| Molecular Formula | C12H11NO6S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid |
| SMILES | O=C1C=CC(=Nc2ccc(O)cc2)C=C1.O=S(=O)(O)O |
| InChI | InChI=1S/C12H9NO2.H2O4S/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10;1-5(2,3)4/h1-8,14H;(H2,1,2,3,4) |
| InChIKey | NSJOFGZZHLDNJV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid?
The IUPAC name of 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid (CID 139489157) is 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid.
What is the SMILES notation for 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid?
The canonical SMILES for 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid is O=C1C=CC(=Nc2ccc(O)cc2)C=C1.O=S(=O)(O)O.
What is the InChIKey of 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid?
The InChIKey is NSJOFGZZHLDNJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2.H2O4S/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10;1-5(2,3)4/h1-8,14H;(H2,1,2,3,4).
What are the key properties of 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid?
4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid has a molecular weight of 297.29 g/mol, XLogP of 1.51, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one;sulfuric acid is sourced from PubChem (CID 139489157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).