About 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane
8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 139490198) has the molecular formula C9H18N2O2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane |
| PubChem CID | 139490198 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCCS(=O)(=O)N1C2CCC1CNC2 |
| InChI | InChI=1S/C9H18N2O2S/c1-2-5-14(12,13)11-8-3-4-9(11)7-10-6-8/h8-10H,2-7H2,1H3 |
| InChIKey | XGTILOCTZKTITB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane?
The IUPAC name of 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane (CID 139490198) is 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane?
The canonical SMILES for 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane is CCCS(=O)(=O)N1C2CCC1CNC2.
What is the InChIKey of 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane?
The InChIKey is XGTILOCTZKTITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2S/c1-2-5-14(12,13)11-8-3-4-9(11)7-10-6-8/h8-10H,2-7H2,1H3.
What are the key properties of 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane?
8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane has a molecular weight of 218.32 g/mol, XLogP of 0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propylsulfonyl-3,8-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 139490198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).