C17H9F9O2 — CID 139490393
4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-(trifluoromethyl)benzaldehyde (PubChem CID 139490393) has the molecular formula C17H9F9O2 and a molecular weight of 416.24 g/mol. Its IUPAC name is 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-(trifluoromethyl)benzaldehyde.
| Compound Name | 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 139490393 |
| Molecular Formula | C17H9F9O2 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-(trifluoromethyl)benzaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9F9O2/c18-15(19,20)13-7-9(8-27)1-6-12(13)10-2-4-11(5-3-10)14(28,16(21,22)23)17(24,25)26/h1-8,28H |
| InChIKey | IPJUQUVHNBCIRF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|