C24H26F6N2O — CID 139490668
2-[4-[4-(3,8-diazabicyclo[3.2.1]octan-8-ylmethyl)-2-ethylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 139490668) has the molecular formula C24H26F6N2O and a molecular weight of 472.47 g/mol. Its IUPAC name is 2-[4-[4-(3,8-diazabicyclo[3.2.1]octan-8-ylmethyl)-2-ethylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[4-(3,8-diazabicyclo[3.2.1]octan-8-ylmethyl)-2-ethylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 139490668 |
| Molecular Formula | C24H26F6N2O |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 2-[4-[4-(3,8-diazabicyclo[3.2.1]octan-8-ylmethyl)-2-ethylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCc1cc(CN2C3CCC2CNC3)ccc1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H26F6N2O/c1-2-16-11-15(14-32-19-8-9-20(32)13-31-12-19)3-10-21(16)17-4-6-18(7-5-17)22(33,23(25,26)27)24(28,29)30/h3-7,10-11,19-20,31,33H,2,8-9,12-14H2,1H3 |
| InChIKey | DLUVJIBQXUDFIO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |