C13H23NO — CID 139491727
5-[1-(2,2-dimethylpropoxy)ethenyl]-6-methyl-1,2,3,4-tetrahydropyridine (PubChem CID 139491727) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 5-[1-(2,2-dimethylpropoxy)ethenyl]-6-methyl-1,2,3,4-tetrahydropyridine.
| Compound Name | 5-[1-(2,2-dimethylpropoxy)ethenyl]-6-methyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 139491727 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 5-[1-(2,2-dimethylpropoxy)ethenyl]-6-methyl-1,2,3,4-tetrahydropyridine |
| SMILES | C=C(OCC(C)(C)C)C1=C(C)NCCC1 |
| InChI | InChI=1S/C13H23NO/c1-10-12(7-6-8-14-10)11(2)15-9-13(3,4)5/h14H,2,6-9H2,1,3-5H3 |
| InChIKey | RKHOGGCVUVHFTF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|