C28H24BrF3N4O2 — CID 139491972
[3-(trifluoromethyl)phenyl] 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 139491972) has the molecular formula C28H24BrF3N4O2 and a molecular weight of 585.42 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl] 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 139491972 |
| Molecular Formula | C28H24BrF3N4O2 |
| Molecular Weight | 585.42 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(Oc1cccc(C(F)(F)F)c1)N1CC2CN(Cc3c(-c4ccc(Br)cc4)nc4ccccn34)CC2C1 |
| InChI | InChI=1S/C28H24BrF3N4O2/c29-22-9-7-18(8-10-22)26-24(36-11-2-1-6-25(36)33-26)17-34-13-19-15-35(16-20(19)14-34)27(37)38-23-5-3-4-21(12-23)28(30,31)32/h1-12,19-20H,13-17H2 |
| InChIKey | LUMLKNBQQCLLQV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.42 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |