C24H27BrN4O2 — CID 139491973
propan-2-yl 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 139491973) has the molecular formula C24H27BrN4O2 and a molecular weight of 483.41 g/mol. Its IUPAC name is propan-2-yl 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | propan-2-yl 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 139491973 |
| Molecular Formula | C24H27BrN4O2 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | propan-2-yl 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)OC(=O)N1CC2CN(Cc3c(-c4ccc(Br)cc4)nc4ccccn34)CC2C1 |
| InChI | InChI=1S/C24H27BrN4O2/c1-16(2)31-24(30)28-13-18-11-27(12-19(18)14-28)15-21-23(17-6-8-20(25)9-7-17)26-22-5-3-4-10-29(21)22/h3-10,16,18-19H,11-15H2,1-2H3 |
| InChIKey | NGLIGRIXZZXCRF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |