C27H24ClFN4O — CID 139491988
[2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-fluorophenyl)methanone (PubChem CID 139491988) has the molecular formula C27H24ClFN4O and a molecular weight of 474.97 g/mol. Its IUPAC name is [2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-fluorophenyl)methanone.
| Compound Name | [2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 139491988 |
| Molecular Formula | C27H24ClFN4O |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [2-[[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1CC2CN(Cc3c(-c4ccc(Cl)cc4)nc4ccccn34)CC2C1 |
| InChI | InChI=1S/C27H24ClFN4O/c28-21-10-8-18(9-11-21)26-24(33-12-4-3-7-25(33)30-26)17-31-13-19-15-32(16-20(19)14-31)27(34)22-5-1-2-6-23(22)29/h1-12,19-20H,13-17H2 |
| InChIKey | YVZFHGSKFXDMSC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |