C23H24BrFN4O2 — CID 139491990
2-fluoroethyl 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 139491990) has the molecular formula C23H24BrFN4O2 and a molecular weight of 487.37 g/mol. Its IUPAC name is 2-fluoroethyl 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | 2-fluoroethyl 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 139491990 |
| Molecular Formula | C23H24BrFN4O2 |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 2-fluoroethyl 2-[[2-(4-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(OCCF)N1CC2CN(Cc3c(-c4ccc(Br)cc4)nc4ccccn34)CC2C1 |
| InChI | InChI=1S/C23H24BrFN4O2/c24-19-6-4-16(5-7-19)22-20(29-9-2-1-3-21(29)26-22)15-27-11-17-13-28(14-18(17)12-27)23(30)31-10-8-25/h1-7,9,17-18H,8,10-15H2 |
| InChIKey | MXVFKRMFVXBQTO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |