About 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene
5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene (PubChem CID 139492202) has the molecular formula C12H13FO
and a molecular weight of 192.23 g/mol. Its IUPAC name is 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene |
| PubChem CID | 139492202 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene |
| SMILES | COc1ccc2c(c1F)C(C)=CCC2 |
| InChI | InChI=1S/C12H13FO/c1-8-4-3-5-9-6-7-10(14-2)12(13)11(8)9/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | TZSDFMRMFQDVPJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene?
The IUPAC name of 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene (CID 139492202) is 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene.
What is the SMILES notation for 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene?
The canonical SMILES for 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene is COc1ccc2c(c1F)C(C)=CCC2.
What is the InChIKey of 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene?
The InChIKey is TZSDFMRMFQDVPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO/c1-8-4-3-5-9-6-7-10(14-2)12(13)11(8)9/h4,6-7H,3,5H2,1-2H3.
What are the key properties of 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene?
5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene has a molecular weight of 192.23 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methoxy-4-methyl-1,2-dihydronaphthalene is sourced from PubChem (CID 139492202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).