C39H54N2O4 — CID 139492319
1-O-[(1R,9S,16S)-16-amino-1-methyl-4-tricyclo[7.6.1.02,7]hexadeca-2(7),3,5-trienyl] 6-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] hexanedioate (PubChem CID 139492319) has the molecular formula C39H54N2O4 and a molecular weight of 614.87 g/mol. Its IUPAC name is 1-O-[(1R,9S,16S)-16-amino-1-methyl-4-tricyclo[7.6.1.02,7]hexadeca-2(7),3,5-trienyl] 6-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] hexanedioate.
| Compound Name | 1-O-[(1R,9S,16S)-16-amino-1-methyl-4-tricyclo[7.6.1.02,7]hexadeca-2(7),3,5-trienyl] 6-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] hexanedioate |
|---|---|
| PubChem CID | 139492319 |
| Molecular Formula | C39H54N2O4 |
| Molecular Weight | 614.87 g/mol |
| Exact Mass | 614.41 |
| IUPAC Name | 1-O-[(1R,9S,16S)-16-amino-1-methyl-4-tricyclo[7.6.1.02,7]hexadeca-2(7),3,5-trienyl] 6-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] hexanedioate |
| SMILES | C[C@@]12CCCCC[C@@H](Cc3ccc(OC(=O)CCCCC(=O)Oc4ccc5c(c4)[C@@]4(C)CCCCCC[C@@H](C5)[C@@H]4N)cc31)C2N |
| InChI | InChI=1S/C39H54N2O4/c1-38-20-10-4-3-6-12-28(36(38)40)22-26-16-18-30(24-32(26)38)44-34(42)14-8-9-15-35(43)45-31-19-17-27-23-29-13-7-5-11-21-39(2,37(29)41)33(27)25-31/h16-19,24-25,28-29,36-37H,3-15,20-23,40-41H2,1-2H3/t28-,29-,36-,37?,38+,39+/m0/s1 |
| InChIKey | WIRGUIXHPXBEKM-RFQHONDYSA-N |
| XLogP | 7.59 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.87 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|