C14H15NOS — CID 139492537
(1S,9S)-14,14-dimethyl-4-thia-8-azatetracyclo[7.4.1.01,9.02,6]tetradeca-2,5,12-trien-11-one (PubChem CID 139492537) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is (1S,9S)-14,14-dimethyl-4-thia-8-azatetracyclo[7.4.1.01,9.02,6]tetradeca-2,5,12-trien-11-one.
| Compound Name | (1S,9S)-14,14-dimethyl-4-thia-8-azatetracyclo[7.4.1.01,9.02,6]tetradeca-2,5,12-trien-11-one |
|---|---|
| PubChem CID | 139492537 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (1S,9S)-14,14-dimethyl-4-thia-8-azatetracyclo[7.4.1.01,9.02,6]tetradeca-2,5,12-trien-11-one |
| SMILES | CC1(C)[C@@]23CC(=O)C=C[C@@]12c1cscc1CN3 |
| InChI | InChI=1S/C14H15NOS/c1-12(2)13-4-3-10(16)5-14(12,13)15-6-9-7-17-8-11(9)13/h3-4,7-8,15H,5-6H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | OZJGDJQTRBSULA-KGLIPLIRSA-N |
| XLogP | 2.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |