C34H50ClF2N5O4S2 — CID 139492914
4-[[(3S)-5-[(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-9-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,5,9-triazacyclododec-1-yl]sulfonyl]-N,N-dimethylaniline (PubChem CID 139492914) has the molecular formula C34H50ClF2N5O4S2 and a molecular weight of 730.39 g/mol. Its IUPAC name is 4-[[(3S)-5-[(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-9-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,5,9-triazacyclododec-1-yl]sulfonyl]-N,N-dimethylaniline.
| Compound Name | 4-[[(3S)-5-[(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-9-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,5,9-triazacyclododec-1-yl]sulfonyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 139492914 |
| Molecular Formula | C34H50ClF2N5O4S2 |
| Molecular Weight | 730.39 g/mol |
| Exact Mass | 729.30 |
| IUPAC Name | 4-[[(3S)-5-[(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-9-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,5,9-triazacyclododec-1-yl]sulfonyl]-N,N-dimethylaniline |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(N(C)C)cc2)CCCN(CC2CCC(F)(F)CC2)CCCN(S(=O)(=O)N2CCc3cc(Cl)ccc3C2)C1 |
| InChI | InChI=1S/C34H50ClF2N5O4S2/c1-27-23-40(47(43,44)33-10-8-32(9-11-33)38(2)3)19-4-17-39(25-28-12-15-34(36,37)16-13-28)18-5-20-41(24-27)48(45,46)42-21-14-29-22-31(35)7-6-30(29)26-42/h6-11,22,27-28H,4-5,12-21,23-26H2,1-3H3/t27-/m0/s1 |
| InChIKey | HCKQJSSFLMVVJA-MHZLTWQESA-N |
| XLogP | 5.56 |
| TPSA | 84.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |