About 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole
4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole (PubChem CID 139494114) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole |
| PubChem CID | 139494114 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole |
| SMILES | CC1=C(C)N(C(C)C)NN1 |
| InChI | InChI=1S/C7H15N3/c1-5(2)10-7(4)6(3)8-9-10/h5,8-9H,1-4H3 |
| InChIKey | SIRJCYYRMZRLSK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole?
The IUPAC name of 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole (CID 139494114) is 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole.
What is the SMILES notation for 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole?
The canonical SMILES for 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole is CC1=C(C)N(C(C)C)NN1.
What is the InChIKey of 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole?
The InChIKey is SIRJCYYRMZRLSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-5(2)10-7(4)6(3)8-9-10/h5,8-9H,1-4H3.
What are the key properties of 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole?
4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole has a molecular weight of 141.22 g/mol, XLogP of 0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-propan-2-yl-1,2-dihydrotriazole is sourced from PubChem (CID 139494114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).