About dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate
dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate (PubChem CID 139494257) has the molecular formula C24H39NO6
and a molecular weight of 437.58 g/mol. Its IUPAC name is dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate.
Molecular Properties
| Compound Name | dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate |
| PubChem CID | 139494257 |
| Molecular Formula | C24H39NO6 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate |
| SMILES | COC(=O)CCCCCC/C=C/C(CCCCCCCC(=O)OC)C1CC(=O)NC1=O |
| InChI | InChI=1S/C24H39NO6/c1-30-22(27)16-12-8-4-3-6-10-14-19(20-18-21(26)25-24(20)29)15-11-7-5-9-13-17-23(28)31-2/h10,14,19-20H,3-9,11-13,15-18H2,1-2H3,(H,25,26,29)/b14-10+ |
| InChIKey | PZAFGOIRKSHGGD-GXDHUFHOSA-N |
| XLogP | 4.24 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate?
The IUPAC name of dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate (CID 139494257) is dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate.
What is the SMILES notation for dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate?
The canonical SMILES for dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate is COC(=O)CCCCCC/C=C/C(CCCCCCCC(=O)OC)C1CC(=O)NC1=O.
What is the InChIKey of dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate?
The InChIKey is PZAFGOIRKSHGGD-GXDHUFHOSA-N. The full InChI is InChI=1S/C24H39NO6/c1-30-22(27)16-12-8-4-3-6-10-14-19(20-18-21(26)25-24(20)29)15-11-7-5-9-13-17-23(28)31-2/h10,14,19-20H,3-9,11-13,15-18H2,1-2H3,(H,25,26,29)/b14-10+.
What are the key properties of dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate?
dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate has a molecular weight of 437.58 g/mol, XLogP of 4.24, 17 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (E)-10-(2,5-dioxopyrrolidin-3-yl)octadec-8-enedioate is sourced from PubChem (CID 139494257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).