C35H38N2O11 — CID 139494520
[(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 1H-pyrrole-2-carboxylate (PubChem CID 139494520) has the molecular formula C35H38N2O11 and a molecular weight of 662.69 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 1H-pyrrole-2-carboxylate.
| Compound Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 139494520 |
| Molecular Formula | C35H38N2O11 |
| Molecular Weight | 662.69 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 1H-pyrrole-2-carboxylate |
| SMILES | COC1[C@@H](OC(=O)c2ccc[nH]2)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C35H38N2O11/c1-17(2)9-10-19-16-20(11-13-23(19)38)31(41)37-25-26(39)21-12-14-24(18(3)28(21)46-33(25)43)45-34-27(40)29(30(44-6)35(4,5)48-34)47-32(42)22-8-7-15-36-22/h7-9,11-16,27,29-30,34,36,38-40H,10H2,1-6H3,(H,37,41)/t27-,29+,30?,34-/m1/s1 |
| InChIKey | JWSWLWCBBGHJOU-NRFDJYFCSA-N |
| XLogP | 4.72 |
| TPSA | 189.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|