C14H24FN3 — CID 139494587
(E)-5-fluoro-N,N',4,5-tetramethyl-2-methylimino-N-prop-2-enylhex-3-enimidamide (PubChem CID 139494587) has the molecular formula C14H24FN3 and a molecular weight of 253.36 g/mol. Its IUPAC name is (E)-5-fluoro-N,N',4,5-tetramethyl-2-methylimino-N-prop-2-enylhex-3-enimidamide.
| Compound Name | (E)-5-fluoro-N,N',4,5-tetramethyl-2-methylimino-N-prop-2-enylhex-3-enimidamide |
|---|---|
| PubChem CID | 139494587 |
| Molecular Formula | C14H24FN3 |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (E)-5-fluoro-N,N',4,5-tetramethyl-2-methylimino-N-prop-2-enylhex-3-enimidamide |
| SMILES | C=CCN(C)C(=N\C)/C(/C=C(\C)C(C)(C)F)=N/C |
| InChI | InChI=1S/C14H24FN3/c1-8-9-18(7)13(17-6)12(16-5)10-11(2)14(3,4)15/h8,10H,1,9H2,2-7H3/b11-10+,16-12+,17-13- |
| InChIKey | HTDANRHGOQCENI-OKMULXFHSA-N |
| XLogP | 2.90 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|