C16H16O5S — CID 139495064
5-[(2-methylphenyl)methoxy]-4-methylsulfonyl-1,3-benzodioxole (PubChem CID 139495064) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is 5-[(2-methylphenyl)methoxy]-4-methylsulfonyl-1,3-benzodioxole.
| Compound Name | 5-[(2-methylphenyl)methoxy]-4-methylsulfonyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 139495064 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 5-[(2-methylphenyl)methoxy]-4-methylsulfonyl-1,3-benzodioxole |
| SMILES | Cc1ccccc1COc1ccc2c(c1S(C)(=O)=O)OCO2 |
| InChI | InChI=1S/C16H16O5S/c1-11-5-3-4-6-12(11)9-19-14-8-7-13-15(21-10-20-13)16(14)22(2,17)18/h3-8H,9-10H2,1-2H3 |
| InChIKey | NYWKHOUOZIZPQS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |